C17H12N2O8S — CID 3887482
methyl 5-[[5-[(5-hydroxy-2-nitrophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]furan-2-carboxylate (PubChem CID 3887482) has the molecular formula C17H12N2O8S and a molecular weight of 404.36 g/mol. Its IUPAC name is methyl 5-[[5-[(5-hydroxy-2-nitrophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[5-[(5-hydroxy-2-nitrophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 3887482 |
| Molecular Formula | C17H12N2O8S |
| Molecular Weight | 404.36 g/mol |
| Exact Mass | 404.03 |
| IUPAC Name | methyl 5-[[5-[(5-hydroxy-2-nitrophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(CN2C(=O)SC(=Cc3cc(O)ccc3[N+](=O)[O-])C2=O)o1 |
| InChI | InChI=1S/C17H12N2O8S/c1-26-16(22)13-5-3-11(27-13)8-18-15(21)14(28-17(18)23)7-9-6-10(20)2-4-12(9)19(24)25/h2-7,20H,8H2,1H3 |
| InChIKey | SXZIWYNSNLWLSW-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 140.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.36 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|