C23H15ClN2O7S — CID 126279126
methyl 2-chloro-5-[[2-[(5E)-2,4-dioxo-5-[(2-oxochromen-3-yl)methylidene]-1,3-thiazolidin-3-yl]acetyl]amino]benzoate (PubChem CID 126279126) has the molecular formula C23H15ClN2O7S and a molecular weight of 498.90 g/mol. Its IUPAC name is methyl 2-chloro-5-[[2-[(5E)-2,4-dioxo-5-[(2-oxochromen-3-yl)methylidene]-1,3-thiazolidin-3-yl]acetyl]amino]benzoate.
| Compound Name | methyl 2-chloro-5-[[2-[(5E)-2,4-dioxo-5-[(2-oxochromen-3-yl)methylidene]-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 126279126 |
| Molecular Formula | C23H15ClN2O7S |
| Molecular Weight | 498.90 g/mol |
| Exact Mass | 498.03 |
| IUPAC Name | methyl 2-chloro-5-[[2-[(5E)-2,4-dioxo-5-[(2-oxochromen-3-yl)methylidene]-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
| SMILES | COC(=O)c1cc(NC(=O)CN2C(=O)S/C(=C/c3cc4ccccc4oc3=O)C2=O)ccc1Cl |
| InChI | InChI=1S/C23H15ClN2O7S/c1-32-22(30)15-10-14(6-7-16(15)24)25-19(27)11-26-20(28)18(34-23(26)31)9-13-8-12-4-2-3-5-17(12)33-21(13)29/h2-10H,11H2,1H3,(H,25,27)/b18-9+ |
| InChIKey | OMIPKPMZZCJHCC-GIJQJNRQSA-N |
| XLogP | 3.91 |
| TPSA | 122.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.90 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|