C22H14N2O7S — CID 126360735
N-(1,3-benzodioxol-5-yl)-2-[(5E)-2,4-dioxo-5-[(2-oxochromen-3-yl)methylidene]-1,3-thiazolidin-3-yl]acetamide (PubChem CID 126360735) has the molecular formula C22H14N2O7S and a molecular weight of 450.43 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-2-[(5E)-2,4-dioxo-5-[(2-oxochromen-3-yl)methylidene]-1,3-thiazolidin-3-yl]acetamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-2-[(5E)-2,4-dioxo-5-[(2-oxochromen-3-yl)methylidene]-1,3-thiazolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 126360735 |
| Molecular Formula | C22H14N2O7S |
| Molecular Weight | 450.43 g/mol |
| Exact Mass | 450.05 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-2-[(5E)-2,4-dioxo-5-[(2-oxochromen-3-yl)methylidene]-1,3-thiazolidin-3-yl]acetamide |
| SMILES | O=C(CN1C(=O)S/C(=C/c2cc3ccccc3oc2=O)C1=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C22H14N2O7S/c25-19(23-14-5-6-16-17(9-14)30-11-29-16)10-24-20(26)18(32-22(24)28)8-13-7-12-3-1-2-4-15(12)31-21(13)27/h1-9H,10-11H2,(H,23,25)/b18-8+ |
| InChIKey | JZDJBSSGNYNVLC-QGMBQPNBSA-N |
| XLogP | 3.20 |
| TPSA | 115.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.43 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|