C24H17ClN2O7S — CID 126280466
ethyl 2-chloro-5-[[2-[(5E)-2,4-dioxo-5-[(2-oxochromen-3-yl)methylidene]-1,3-thiazolidin-3-yl]acetyl]amino]benzoate (PubChem CID 126280466) has the molecular formula C24H17ClN2O7S and a molecular weight of 512.93 g/mol. Its IUPAC name is ethyl 2-chloro-5-[[2-[(5E)-2,4-dioxo-5-[(2-oxochromen-3-yl)methylidene]-1,3-thiazolidin-3-yl]acetyl]amino]benzoate.
| Compound Name | ethyl 2-chloro-5-[[2-[(5E)-2,4-dioxo-5-[(2-oxochromen-3-yl)methylidene]-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 126280466 |
| Molecular Formula | C24H17ClN2O7S |
| Molecular Weight | 512.93 g/mol |
| Exact Mass | 512.04 |
| IUPAC Name | ethyl 2-chloro-5-[[2-[(5E)-2,4-dioxo-5-[(2-oxochromen-3-yl)methylidene]-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1cc(NC(=O)CN2C(=O)S/C(=C/c3cc4ccccc4oc3=O)C2=O)ccc1Cl |
| InChI | InChI=1S/C24H17ClN2O7S/c1-2-33-23(31)16-11-15(7-8-17(16)25)26-20(28)12-27-21(29)19(35-24(27)32)10-14-9-13-5-3-4-6-18(13)34-22(14)30/h3-11H,2,12H2,1H3,(H,26,28)/b19-10+ |
| InChIKey | COTCQDIGQLPKMD-VXLYETTFSA-N |
| XLogP | 4.30 |
| TPSA | 122.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.93 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|