C24H21ClN2O6S — CID 126334663
ethyl 2-chloro-5-[[2-[(5E)-2,4-dioxo-5-[(3-prop-2-enoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]acetyl]amino]benzoate (PubChem CID 126334663) has the molecular formula C24H21ClN2O6S and a molecular weight of 500.96 g/mol. Its IUPAC name is ethyl 2-chloro-5-[[2-[(5E)-2,4-dioxo-5-[(3-prop-2-enoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]acetyl]amino]benzoate.
| Compound Name | ethyl 2-chloro-5-[[2-[(5E)-2,4-dioxo-5-[(3-prop-2-enoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 126334663 |
| Molecular Formula | C24H21ClN2O6S |
| Molecular Weight | 500.96 g/mol |
| Exact Mass | 500.08 |
| IUPAC Name | ethyl 2-chloro-5-[[2-[(5E)-2,4-dioxo-5-[(3-prop-2-enoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
| SMILES | C=CCOc1cccc(/C=C2/SC(=O)N(CC(=O)Nc3ccc(Cl)c(C(=O)OCC)c3)C2=O)c1 |
| InChI | InChI=1S/C24H21ClN2O6S/c1-3-10-33-17-7-5-6-15(11-17)12-20-22(29)27(24(31)34-20)14-21(28)26-16-8-9-19(25)18(13-16)23(30)32-4-2/h3,5-9,11-13H,1,4,10,14H2,2H3,(H,26,28)/b20-12+ |
| InChIKey | WXKJQGXVVRFFCU-UDWIEESQSA-N |
| XLogP | 4.76 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.96 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|