C25H23ClN2O7S — CID 126213253
ethyl 2-chloro-5-[[2-[(5Z)-5-[(4-hydroxy-3-methoxy-5-prop-2-enylphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate (PubChem CID 126213253) has the molecular formula C25H23ClN2O7S and a molecular weight of 530.99 g/mol. Its IUPAC name is ethyl 2-chloro-5-[[2-[(5Z)-5-[(4-hydroxy-3-methoxy-5-prop-2-enylphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate.
| Compound Name | ethyl 2-chloro-5-[[2-[(5Z)-5-[(4-hydroxy-3-methoxy-5-prop-2-enylphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 126213253 |
| Molecular Formula | C25H23ClN2O7S |
| Molecular Weight | 530.99 g/mol |
| Exact Mass | 530.09 |
| IUPAC Name | ethyl 2-chloro-5-[[2-[(5Z)-5-[(4-hydroxy-3-methoxy-5-prop-2-enylphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
| SMILES | C=CCc1cc(/C=C2\SC(=O)N(CC(=O)Nc3ccc(Cl)c(C(=O)OCC)c3)C2=O)cc(OC)c1O |
| InChI | InChI=1S/C25H23ClN2O7S/c1-4-6-15-9-14(10-19(34-3)22(15)30)11-20-23(31)28(25(33)36-20)13-21(29)27-16-7-8-18(26)17(12-16)24(32)35-5-2/h4,7-12,30H,1,5-6,13H2,2-3H3,(H,27,29)/b20-11- |
| InChIKey | ZIBKZJQNNPPCOO-JAIQZWGSSA-N |
| XLogP | 4.63 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.99 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|