C23H19ClN2O5S — CID 92950148
ethyl 2-chloro-5-[[2-[(5E)-2,4-dioxo-5-[(Z)-3-phenylprop-2-enylidene]-1,3-thiazolidin-3-yl]acetyl]amino]benzoate (PubChem CID 92950148) has the molecular formula C23H19ClN2O5S and a molecular weight of 470.93 g/mol. Its IUPAC name is ethyl 2-chloro-5-[[2-[(5E)-2,4-dioxo-5-[(Z)-3-phenylprop-2-enylidene]-1,3-thiazolidin-3-yl]acetyl]amino]benzoate.
| Compound Name | ethyl 2-chloro-5-[[2-[(5E)-2,4-dioxo-5-[(Z)-3-phenylprop-2-enylidene]-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 92950148 |
| Molecular Formula | C23H19ClN2O5S |
| Molecular Weight | 470.93 g/mol |
| Exact Mass | 470.07 |
| IUPAC Name | ethyl 2-chloro-5-[[2-[(5E)-2,4-dioxo-5-[(Z)-3-phenylprop-2-enylidene]-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1cc(NC(=O)CN2C(=O)S/C(=C/C=C\c3ccccc3)C2=O)ccc1Cl |
| InChI | InChI=1S/C23H19ClN2O5S/c1-2-31-22(29)17-13-16(11-12-18(17)24)25-20(27)14-26-21(28)19(32-23(26)30)10-6-9-15-7-4-3-5-8-15/h3-13H,2,14H2,1H3,(H,25,27)/b9-6-,19-10+ |
| InChIKey | RZUHJRLXPXYWBG-IGHDPAQPSA-N |
| XLogP | 4.75 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.93 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|