C21H16N2O6S — CID 4975614
4-[[2-(5-cinnamylidene-2,4-dioxo-1,3-thiazolidin-3-yl)acetyl]amino]-2-hydroxybenzoic acid (PubChem CID 4975614) has the molecular formula C21H16N2O6S and a molecular weight of 424.43 g/mol. Its IUPAC name is 4-[[2-(5-cinnamylidene-2,4-dioxo-1,3-thiazolidin-3-yl)acetyl]amino]-2-hydroxybenzoic acid.
| Compound Name | 4-[[2-(5-cinnamylidene-2,4-dioxo-1,3-thiazolidin-3-yl)acetyl]amino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 4975614 |
| Molecular Formula | C21H16N2O6S |
| Molecular Weight | 424.43 g/mol |
| Exact Mass | 424.07 |
| IUPAC Name | 4-[[2-(5-cinnamylidene-2,4-dioxo-1,3-thiazolidin-3-yl)acetyl]amino]-2-hydroxybenzoic acid |
| SMILES | O=C(CN1C(=O)SC(=CC=Cc2ccccc2)C1=O)Nc1ccc(C(=O)O)c(O)c1 |
| InChI | InChI=1S/C21H16N2O6S/c24-16-11-14(9-10-15(16)20(27)28)22-18(25)12-23-19(26)17(30-21(23)29)8-4-7-13-5-2-1-3-6-13/h1-11,24H,12H2,(H,22,25)(H,27,28) |
| InChIKey | OQIGLCYPGOXTRD-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.43 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|