C20H16N2O6S — CID 27425043
2-hydroxy-4-[[2-[(5Z)-5-[(3-methylphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoic acid (PubChem CID 27425043) has the molecular formula C20H16N2O6S and a molecular weight of 412.42 g/mol. Its IUPAC name is 2-hydroxy-4-[[2-[(5Z)-5-[(3-methylphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoic acid.
| Compound Name | 2-hydroxy-4-[[2-[(5Z)-5-[(3-methylphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 27425043 |
| Molecular Formula | C20H16N2O6S |
| Molecular Weight | 412.42 g/mol |
| Exact Mass | 412.07 |
| IUPAC Name | 2-hydroxy-4-[[2-[(5Z)-5-[(3-methylphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoic acid |
| SMILES | Cc1cccc(/C=C2\SC(=O)N(CC(=O)Nc3ccc(C(=O)O)c(O)c3)C2=O)c1 |
| InChI | InChI=1S/C20H16N2O6S/c1-11-3-2-4-12(7-11)8-16-18(25)22(20(28)29-16)10-17(24)21-13-5-6-14(19(26)27)15(23)9-13/h2-9,23H,10H2,1H3,(H,21,24)(H,26,27)/b16-8- |
| InChIKey | YWTFDLTZUJDNMP-PXNMLYILSA-N |
| XLogP | 3.07 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.42 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|