C20H16FN3O7S — CID 126226909
2-[(5E)-5-[(2,4-dimethoxy-5-nitrophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(3-fluorophenyl)acetamide (PubChem CID 126226909) has the molecular formula C20H16FN3O7S and a molecular weight of 461.43 g/mol. Its IUPAC name is 2-[(5E)-5-[(2,4-dimethoxy-5-nitrophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(3-fluorophenyl)acetamide.
| Compound Name | 2-[(5E)-5-[(2,4-dimethoxy-5-nitrophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(3-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 126226909 |
| Molecular Formula | C20H16FN3O7S |
| Molecular Weight | 461.43 g/mol |
| Exact Mass | 461.07 |
| IUPAC Name | 2-[(5E)-5-[(2,4-dimethoxy-5-nitrophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(3-fluorophenyl)acetamide |
| SMILES | COc1cc(OC)c([N+](=O)[O-])cc1/C=C1/SC(=O)N(CC(=O)Nc2cccc(F)c2)C1=O |
| InChI | InChI=1S/C20H16FN3O7S/c1-30-15-9-16(31-2)14(24(28)29)6-11(15)7-17-19(26)23(20(27)32-17)10-18(25)22-13-5-3-4-12(21)8-13/h3-9H,10H2,1-2H3,(H,22,25)/b17-7+ |
| InChIKey | DTTYYFKROYGGTJ-REZTVBANSA-N |
| XLogP | 3.43 |
| TPSA | 128.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.43 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|