C14H12N2O8S — CID 126130215
2-[(5E)-5-[(2,4-dimethoxy-5-nitrophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid (PubChem CID 126130215) has the molecular formula C14H12N2O8S and a molecular weight of 368.32 g/mol. Its IUPAC name is 2-[(5E)-5-[(2,4-dimethoxy-5-nitrophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid.
| Compound Name | 2-[(5E)-5-[(2,4-dimethoxy-5-nitrophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 126130215 |
| Molecular Formula | C14H12N2O8S |
| Molecular Weight | 368.32 g/mol |
| Exact Mass | 368.03 |
| IUPAC Name | 2-[(5E)-5-[(2,4-dimethoxy-5-nitrophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid |
| SMILES | COc1cc(OC)c([N+](=O)[O-])cc1/C=C1/SC(=O)N(CC(=O)O)C1=O |
| InChI | InChI=1S/C14H12N2O8S/c1-23-9-5-10(24-2)8(16(21)22)3-7(9)4-11-13(19)15(6-12(17)18)14(20)25-11/h3-5H,6H2,1-2H3,(H,17,18)/b11-4+ |
| InChIKey | IZCDNJBQLZDDDO-NYYWCZLTSA-N |
| XLogP | 1.73 |
| TPSA | 136.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.32 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|