C20H16N3O7S- — CID 2254880
2-methoxy-4-[(Z)-[3-[2-(3-methylanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-6-nitrophenolate (PubChem CID 2254880) has the molecular formula C20H16N3O7S- and a molecular weight of 442.43 g/mol. Its IUPAC name is 2-methoxy-4-[(Z)-[3-[2-(3-methylanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-6-nitrophenolate.
| Compound Name | 2-methoxy-4-[(Z)-[3-[2-(3-methylanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-6-nitrophenolate |
|---|---|
| PubChem CID | 2254880 |
| Molecular Formula | C20H16N3O7S- |
| Molecular Weight | 442.43 g/mol |
| Exact Mass | 442.07 |
| IUPAC Name | 2-methoxy-4-[(Z)-[3-[2-(3-methylanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-6-nitrophenolate |
| SMILES | COc1cc(/C=C2\SC(=O)N(CC(=O)Nc3cccc(C)c3)C2=O)cc([N+](=O)[O-])c1[O-] |
| InChI | InChI=1S/C20H17N3O7S/c1-11-4-3-5-13(6-11)21-17(24)10-22-19(26)16(31-20(22)27)9-12-7-14(23(28)29)18(25)15(8-12)30-2/h3-9,25H,10H2,1-2H3,(H,21,24)/p-1/b16-9- |
| InChIKey | ZHNYUYOPWLJLBZ-SXGWCWSVSA-M |
| XLogP | 2.66 |
| TPSA | 141.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.43 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|