C27H19F3N4O8S — CID 126271772
2-[(5Z)-5-[[3-methoxy-4-[2-(3-nitroanilino)-2-oxoethoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 126271772) has the molecular formula C27H19F3N4O8S and a molecular weight of 616.53 g/mol. Its IUPAC name is 2-[(5Z)-5-[[3-methoxy-4-[2-(3-nitroanilino)-2-oxoethoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-[(5Z)-5-[[3-methoxy-4-[2-(3-nitroanilino)-2-oxoethoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 126271772 |
| Molecular Formula | C27H19F3N4O8S |
| Molecular Weight | 616.53 g/mol |
| Exact Mass | 616.09 |
| IUPAC Name | 2-[(5Z)-5-[[3-methoxy-4-[2-(3-nitroanilino)-2-oxoethoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | COc1cc(/C=C2\SC(=O)N(CC(=O)Nc3ccc(F)c(F)c3F)C2=O)ccc1OCC(=O)Nc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C27H19F3N4O8S/c1-41-20-9-14(5-8-19(20)42-13-23(36)31-15-3-2-4-16(11-15)34(39)40)10-21-26(37)33(27(38)43-21)12-22(35)32-18-7-6-17(28)24(29)25(18)30/h2-11H,12-13H2,1H3,(H,31,36)(H,32,35)/b21-10- |
| InChIKey | UATJMMWTSSZVQL-FBHDLOMBSA-N |
| XLogP | 4.71 |
| TPSA | 157.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.53 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|