C25H18N2O8S2 — CID 126170161
5-[5-[(E)-[3-[2-(3-methylsulfanylanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzene-1,3-dicarboxylic acid (PubChem CID 126170161) has the molecular formula C25H18N2O8S2 and a molecular weight of 538.56 g/mol. Its IUPAC name is 5-[5-[(E)-[3-[2-(3-methylsulfanylanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzene-1,3-dicarboxylic acid.
| Compound Name | 5-[5-[(E)-[3-[2-(3-methylsulfanylanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 126170161 |
| Molecular Formula | C25H18N2O8S2 |
| Molecular Weight | 538.56 g/mol |
| Exact Mass | 538.05 |
| IUPAC Name | 5-[5-[(E)-[3-[2-(3-methylsulfanylanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzene-1,3-dicarboxylic acid |
| SMILES | CSc1cccc(NC(=O)CN2C(=O)S/C(=C/c3ccc(-c4cc(C(=O)O)cc(C(=O)O)c4)o3)C2=O)c1 |
| InChI | InChI=1S/C25H18N2O8S2/c1-36-18-4-2-3-16(10-18)26-21(28)12-27-22(29)20(37-25(27)34)11-17-5-6-19(35-17)13-7-14(23(30)31)9-15(8-13)24(32)33/h2-11H,12H2,1H3,(H,26,28)(H,30,31)(H,32,33)/b20-11+ |
| InChIKey | ZAJKSMANZFEDRY-RGVLZGJSSA-N |
| XLogP | 4.74 |
| TPSA | 154.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.56 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_G(7)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|