C22H14Cl2N2O3S3 — CID 126028766
N-(4-chlorophenyl)-2-[(5Z)-5-[[5-(4-chlorophenyl)sulfanylthiophen-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide (PubChem CID 126028766) has the molecular formula C22H14Cl2N2O3S3 and a molecular weight of 521.47 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-[(5Z)-5-[[5-(4-chlorophenyl)sulfanylthiophen-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide.
| Compound Name | N-(4-chlorophenyl)-2-[(5Z)-5-[[5-(4-chlorophenyl)sulfanylthiophen-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 126028766 |
| Molecular Formula | C22H14Cl2N2O3S3 |
| Molecular Weight | 521.47 g/mol |
| Exact Mass | 519.95 |
| IUPAC Name | N-(4-chlorophenyl)-2-[(5Z)-5-[[5-(4-chlorophenyl)sulfanylthiophen-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
| SMILES | O=C(CN1C(=O)S/C(=C\c2ccc(Sc3ccc(Cl)cc3)s2)C1=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H14Cl2N2O3S3/c23-13-1-5-15(6-2-13)25-19(27)12-26-21(28)18(32-22(26)29)11-17-9-10-20(31-17)30-16-7-3-14(24)4-8-16/h1-11H,12H2,(H,25,27)/b18-11- |
| InChIKey | HZXXCRAOUPXSQJ-WQRHYEAKSA-N |
| XLogP | 6.88 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.47 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|