C22H22BrN3O5 — CID 126252978
2-[(4E)-4-[(2-bromo-5-ethoxy-4-hydroxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(2-ethylphenyl)acetamide (PubChem CID 126252978) has the molecular formula C22H22BrN3O5 and a molecular weight of 488.34 g/mol. Its IUPAC name is 2-[(4E)-4-[(2-bromo-5-ethoxy-4-hydroxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(2-ethylphenyl)acetamide.
| Compound Name | 2-[(4E)-4-[(2-bromo-5-ethoxy-4-hydroxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(2-ethylphenyl)acetamide |
|---|---|
| PubChem CID | 126252978 |
| Molecular Formula | C22H22BrN3O5 |
| Molecular Weight | 488.34 g/mol |
| Exact Mass | 487.07 |
| IUPAC Name | 2-[(4E)-4-[(2-bromo-5-ethoxy-4-hydroxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(2-ethylphenyl)acetamide |
| SMILES | CCOc1cc(/C=C2/NC(=O)N(CC(=O)Nc3ccccc3CC)C2=O)c(Br)cc1O |
| InChI | InChI=1S/C22H22BrN3O5/c1-3-13-7-5-6-8-16(13)24-20(28)12-26-21(29)17(25-22(26)30)9-14-10-19(31-4-2)18(27)11-15(14)23/h5-11,27H,3-4,12H2,1-2H3,(H,24,28)(H,25,30)/b17-9+ |
| InChIKey | DQHRKMKISNNXMV-RQZCQDPDSA-N |
| XLogP | 3.65 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.34 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|