C23H19N3O5 — CID 126181612
(5E)-3-ethyl-5-[[2-[(4-nitrophenyl)methoxy]naphthalen-1-yl]methylidene]imidazolidine-2,4-dione (PubChem CID 126181612) has the molecular formula C23H19N3O5 and a molecular weight of 417.42 g/mol. Its IUPAC name is (5E)-3-ethyl-5-[[2-[(4-nitrophenyl)methoxy]naphthalen-1-yl]methylidene]imidazolidine-2,4-dione.
| Compound Name | (5E)-3-ethyl-5-[[2-[(4-nitrophenyl)methoxy]naphthalen-1-yl]methylidene]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 126181612 |
| Molecular Formula | C23H19N3O5 |
| Molecular Weight | 417.42 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | (5E)-3-ethyl-5-[[2-[(4-nitrophenyl)methoxy]naphthalen-1-yl]methylidene]imidazolidine-2,4-dione |
| SMILES | CCN1C(=O)N/C(=C/c2c(OCc3ccc([N+](=O)[O-])cc3)ccc3ccccc23)C1=O |
| InChI | InChI=1S/C23H19N3O5/c1-2-25-22(27)20(24-23(25)28)13-19-18-6-4-3-5-16(18)9-12-21(19)31-14-15-7-10-17(11-8-15)26(29)30/h3-13H,2,14H2,1H3,(H,24,28)/b20-13+ |
| InChIKey | XHYCLKNQPXOFDW-DEDYPNTBSA-N |
| XLogP | 4.24 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.42 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|