C31H24N4O4 — CID 126110857
2-[(4E)-4-[[2-[(2-cyanophenyl)methoxy]naphthalen-1-yl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(3-methylphenyl)acetamide (PubChem CID 126110857) has the molecular formula C31H24N4O4 and a molecular weight of 516.56 g/mol. Its IUPAC name is 2-[(4E)-4-[[2-[(2-cyanophenyl)methoxy]naphthalen-1-yl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(3-methylphenyl)acetamide.
| Compound Name | 2-[(4E)-4-[[2-[(2-cyanophenyl)methoxy]naphthalen-1-yl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(3-methylphenyl)acetamide |
|---|---|
| PubChem CID | 126110857 |
| Molecular Formula | C31H24N4O4 |
| Molecular Weight | 516.56 g/mol |
| Exact Mass | 516.18 |
| IUPAC Name | 2-[(4E)-4-[[2-[(2-cyanophenyl)methoxy]naphthalen-1-yl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(3-methylphenyl)acetamide |
| SMILES | Cc1cccc(NC(=O)CN2C(=O)N/C(=C/c3c(OCc4ccccc4C#N)ccc4ccccc34)C2=O)c1 |
| InChI | InChI=1S/C31H24N4O4/c1-20-7-6-11-24(15-20)33-29(36)18-35-30(37)27(34-31(35)38)16-26-25-12-5-4-8-21(25)13-14-28(26)39-19-23-10-3-2-9-22(23)17-32/h2-16H,18-19H2,1H3,(H,33,36)(H,34,38)/b27-16+ |
| InChIKey | FPUPRZKZNLHBKW-JVWAILMASA-N |
| XLogP | 5.13 |
| TPSA | 111.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.56 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|