C21H18N2O7S — CID 16632172
ethyl 4-[[2-[(5Z)-5-[(2,4-dihydroxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate (PubChem CID 16632172) has the molecular formula C21H18N2O7S and a molecular weight of 442.45 g/mol. Its IUPAC name is ethyl 4-[[2-[(5Z)-5-[(2,4-dihydroxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-[(5Z)-5-[(2,4-dihydroxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 16632172 |
| Molecular Formula | C21H18N2O7S |
| Molecular Weight | 442.45 g/mol |
| Exact Mass | 442.08 |
| IUPAC Name | ethyl 4-[[2-[(5Z)-5-[(2,4-dihydroxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)CN2C(=O)S/C(=C\c3ccc(O)cc3O)C2=O)cc1 |
| InChI | InChI=1S/C21H18N2O7S/c1-2-30-20(28)12-3-6-14(7-4-12)22-18(26)11-23-19(27)17(31-21(23)29)9-13-5-8-15(24)10-16(13)25/h3-10,24-25H,2,11H2,1H3,(H,22,26)/b17-9- |
| InChIKey | ZWAWBEGDZVFIIR-MFOYZWKCSA-N |
| XLogP | 2.95 |
| TPSA | 133.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.45 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|