C18H13Br2N3O5S3 — CID 16629315
2-[(5Z)-5-[(3,5-dibromo-2-hydroxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-sulfamoylphenyl)acetamide (PubChem CID 16629315) has the molecular formula C18H13Br2N3O5S3 and a molecular weight of 607.33 g/mol. Its IUPAC name is 2-[(5Z)-5-[(3,5-dibromo-2-hydroxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-sulfamoylphenyl)acetamide.
| Compound Name | 2-[(5Z)-5-[(3,5-dibromo-2-hydroxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 16629315 |
| Molecular Formula | C18H13Br2N3O5S3 |
| Molecular Weight | 607.33 g/mol |
| Exact Mass | 604.84 |
| IUPAC Name | 2-[(5Z)-5-[(3,5-dibromo-2-hydroxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-sulfamoylphenyl)acetamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)CN2C(=O)/C(=C/c3cc(Br)cc(Br)c3O)SC2=S)cc1 |
| InChI | InChI=1S/C18H13Br2N3O5S3/c19-10-5-9(16(25)13(20)7-10)6-14-17(26)23(18(29)30-14)8-15(24)22-11-1-3-12(4-2-11)31(21,27)28/h1-7,25H,8H2,(H,22,24)(H2,21,27,28)/b14-6- |
| InChIKey | DMYPYRMDINTGQP-NSIKDUERSA-N |
| XLogP | 3.40 |
| TPSA | 129.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.33 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|