C19H11Br2F3N2O3S2 — CID 16629169
2-[(5Z)-5-[(3,5-dibromo-2-hydroxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 16629169) has the molecular formula C19H11Br2F3N2O3S2 and a molecular weight of 596.24 g/mol. Its IUPAC name is 2-[(5Z)-5-[(3,5-dibromo-2-hydroxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[(5Z)-5-[(3,5-dibromo-2-hydroxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 16629169 |
| Molecular Formula | C19H11Br2F3N2O3S2 |
| Molecular Weight | 596.24 g/mol |
| Exact Mass | 593.85 |
| IUPAC Name | 2-[(5Z)-5-[(3,5-dibromo-2-hydroxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(CN1C(=O)/C(=C/c2cc(Br)cc(Br)c2O)SC1=S)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H11Br2F3N2O3S2/c20-11-4-9(16(28)13(21)7-11)5-14-17(29)26(18(30)31-14)8-15(27)25-12-3-1-2-10(6-12)19(22,23)24/h1-7,28H,8H2,(H,25,27)/b14-5- |
| InChIKey | OQPCGQHVYFIEPM-RZNTYIFUSA-N |
| XLogP | 5.78 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.24 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|