C18H18Br2N2O5S2 — CID 16631069
2-[6-[(5Z)-5-[(3,5-dibromo-2-hydroxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoylamino]acetic acid (PubChem CID 16631069) has the molecular formula C18H18Br2N2O5S2 and a molecular weight of 566.29 g/mol. Its IUPAC name is 2-[6-[(5Z)-5-[(3,5-dibromo-2-hydroxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoylamino]acetic acid.
| Compound Name | 2-[6-[(5Z)-5-[(3,5-dibromo-2-hydroxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoylamino]acetic acid |
|---|---|
| PubChem CID | 16631069 |
| Molecular Formula | C18H18Br2N2O5S2 |
| Molecular Weight | 566.29 g/mol |
| Exact Mass | 563.90 |
| IUPAC Name | 2-[6-[(5Z)-5-[(3,5-dibromo-2-hydroxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoylamino]acetic acid |
| SMILES | O=C(O)CNC(=O)CCCCCN1C(=O)/C(=C/c2cc(Br)cc(Br)c2O)SC1=S |
| InChI | InChI=1S/C18H18Br2N2O5S2/c19-11-6-10(16(26)12(20)8-11)7-13-17(27)22(18(28)29-13)5-3-1-2-4-14(23)21-9-15(24)25/h6-8,26H,1-5,9H2,(H,21,23)(H,24,25)/b13-7- |
| InChIKey | XQUGQDCFNRFPFU-QPEQYQDCSA-N |
| XLogP | 3.88 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.29 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|