C18H14ClFN2O3S2 — CID 4033002
N-(3-chloro-4-fluorophenyl)-4-[5-(furan-2-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanamide (PubChem CID 4033002) has the molecular formula C18H14ClFN2O3S2 and a molecular weight of 424.91 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-4-[5-(furan-2-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-4-[5-(furan-2-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanamide |
|---|---|
| PubChem CID | 4033002 |
| Molecular Formula | C18H14ClFN2O3S2 |
| Molecular Weight | 424.91 g/mol |
| Exact Mass | 424.01 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-4-[5-(furan-2-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanamide |
| SMILES | O=C(CCCN1C(=O)C(=Cc2ccco2)SC1=S)Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C18H14ClFN2O3S2/c19-13-9-11(5-6-14(13)20)21-16(23)4-1-7-22-17(24)15(27-18(22)26)10-12-3-2-8-25-12/h2-3,5-6,8-10H,1,4,7H2,(H,21,23) |
| InChIKey | DQMQTMMBJXPHFV-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.91 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|