C19H20N4O4S — CID 56730769
N-(3-imidazol-1-ylpropyl)-2-[(5E)-5-[(2-methoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide (PubChem CID 56730769) has the molecular formula C19H20N4O4S and a molecular weight of 400.46 g/mol. Its IUPAC name is N-(3-imidazol-1-ylpropyl)-2-[(5E)-5-[(2-methoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide.
| Compound Name | N-(3-imidazol-1-ylpropyl)-2-[(5E)-5-[(2-methoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 56730769 |
| Molecular Formula | C19H20N4O4S |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | N-(3-imidazol-1-ylpropyl)-2-[(5E)-5-[(2-methoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
| SMILES | COc1ccccc1/C=C1/SC(=O)N(CC(=O)NCCCn2ccnc2)C1=O |
| InChI | InChI=1S/C19H20N4O4S/c1-27-15-6-3-2-5-14(15)11-16-18(25)23(19(26)28-16)12-17(24)21-7-4-9-22-10-8-20-13-22/h2-3,5-6,8,10-11,13H,4,7,9,12H2,1H3,(H,21,24)/b16-11+ |
| InChIKey | CHBNQJOODLFUPK-LFIBNONCSA-N |
| XLogP | 2.13 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|