C29H30N4O5S2 — CID 4759508
methyl 4-[[3-[6-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]-6-oxohexyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]benzoate (PubChem CID 4759508) has the molecular formula C29H30N4O5S2 and a molecular weight of 578.72 g/mol. Its IUPAC name is methyl 4-[[3-[6-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]-6-oxohexyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]benzoate.
| Compound Name | methyl 4-[[3-[6-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]-6-oxohexyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]benzoate |
|---|---|
| PubChem CID | 4759508 |
| Molecular Formula | C29H30N4O5S2 |
| Molecular Weight | 578.72 g/mol |
| Exact Mass | 578.17 |
| IUPAC Name | methyl 4-[[3-[6-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]-6-oxohexyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]benzoate |
| SMILES | COC(=O)c1ccc(C=C2SC(=S)N(CCCCCC(=O)Nc3c(C)n(C)n(-c4ccccc4)c3=O)C2=O)cc1 |
| InChI | InChI=1S/C29H30N4O5S2/c1-19-25(27(36)33(31(19)2)22-10-6-4-7-11-22)30-24(34)12-8-5-9-17-32-26(35)23(40-29(32)39)18-20-13-15-21(16-14-20)28(37)38-3/h4,6-7,10-11,13-16,18H,5,8-9,12,17H2,1-3H3,(H,30,34) |
| InChIKey | MJXHIPOGYLJZLE-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 102.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.72 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|