C27H21N3O7S — CID 18871377
ethyl 4-[[4-[[(5Z)-5-[(3-nitrophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]benzoyl]amino]benzoate (PubChem CID 18871377) has the molecular formula C27H21N3O7S and a molecular weight of 531.55 g/mol. Its IUPAC name is ethyl 4-[[4-[[(5Z)-5-[(3-nitrophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]benzoyl]amino]benzoate.
| Compound Name | ethyl 4-[[4-[[(5Z)-5-[(3-nitrophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]benzoyl]amino]benzoate |
|---|---|
| PubChem CID | 18871377 |
| Molecular Formula | C27H21N3O7S |
| Molecular Weight | 531.55 g/mol |
| Exact Mass | 531.11 |
| IUPAC Name | ethyl 4-[[4-[[(5Z)-5-[(3-nitrophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]benzoyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)c2ccc(CN3C(=O)S/C(=C\c4cccc([N+](=O)[O-])c4)C3=O)cc2)cc1 |
| InChI | InChI=1S/C27H21N3O7S/c1-2-37-26(33)20-10-12-21(13-11-20)28-24(31)19-8-6-17(7-9-19)16-29-25(32)23(38-27(29)34)15-18-4-3-5-22(14-18)30(35)36/h3-15H,2,16H2,1H3,(H,28,31)/b23-15- |
| InChIKey | KDIMBTRGANCMOF-HAHDFKILSA-N |
| XLogP | 5.26 |
| TPSA | 135.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.55 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|