C21H19BrN2O4S — CID 137020797
methyl 2-[4-[(Z)-[2-(4-bromo-3,5-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate (PubChem CID 137020797) has the molecular formula C21H19BrN2O4S and a molecular weight of 475.36 g/mol. Its IUPAC name is methyl 2-[4-[(Z)-[2-(4-bromo-3,5-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate.
| Compound Name | methyl 2-[4-[(Z)-[2-(4-bromo-3,5-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 137020797 |
| Molecular Formula | C21H19BrN2O4S |
| Molecular Weight | 475.36 g/mol |
| Exact Mass | 474.02 |
| IUPAC Name | methyl 2-[4-[(Z)-[2-(4-bromo-3,5-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate |
| SMILES | COC(=O)COc1ccc(/C=C2\S/C(=N/c3cc(C)c(Br)c(C)c3)NC2=O)cc1 |
| InChI | InChI=1S/C21H19BrN2O4S/c1-12-8-15(9-13(2)19(12)22)23-21-24-20(26)17(29-21)10-14-4-6-16(7-5-14)28-11-18(25)27-3/h4-10H,11H2,1-3H3,(H,23,24,26)/b17-10- |
| InChIKey | ABLXAYUAJXHBGR-YVLHZVERSA-N |
| XLogP | 4.51 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.36 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|