C17H21BrO3 — CID 9028693
(2E,6R)-2-[(3-bromo-5-ethoxy-4-methoxyphenyl)methylidene]-6-methylcyclohexan-1-one (PubChem CID 9028693) has the molecular formula C17H21BrO3 and a molecular weight of 353.26 g/mol. Its IUPAC name is (2E,6R)-2-[(3-bromo-5-ethoxy-4-methoxyphenyl)methylidene]-6-methylcyclohexan-1-one.
| Compound Name | (2E,6R)-2-[(3-bromo-5-ethoxy-4-methoxyphenyl)methylidene]-6-methylcyclohexan-1-one |
|---|---|
| PubChem CID | 9028693 |
| Molecular Formula | C17H21BrO3 |
| Molecular Weight | 353.26 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | (2E,6R)-2-[(3-bromo-5-ethoxy-4-methoxyphenyl)methylidene]-6-methylcyclohexan-1-one |
| SMILES | CCOc1cc(/C=C2\CCC[C@@H](C)C2=O)cc(Br)c1OC |
| InChI | InChI=1S/C17H21BrO3/c1-4-21-15-10-12(9-14(18)17(15)20-3)8-13-7-5-6-11(2)16(13)19/h8-11H,4-7H2,1-3H3/b13-8+/t11-/m1/s1 |
| InChIKey | JYRSEYYSKJHDPU-KAQJVSAMSA-N |
| XLogP | 4.63 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.26 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|