C21H29NO4 — CID 9028959
(2R)-2-[2-ethoxy-4-[(E)-[(3R)-3-methyl-2-oxocyclohexylidene]methyl]phenoxy]-N,N-dimethylpropanamide (PubChem CID 9028959) has the molecular formula C21H29NO4 and a molecular weight of 359.47 g/mol. Its IUPAC name is (2R)-2-[2-ethoxy-4-[(E)-[(3R)-3-methyl-2-oxocyclohexylidene]methyl]phenoxy]-N,N-dimethylpropanamide.
| Compound Name | (2R)-2-[2-ethoxy-4-[(E)-[(3R)-3-methyl-2-oxocyclohexylidene]methyl]phenoxy]-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 9028959 |
| Molecular Formula | C21H29NO4 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | (2R)-2-[2-ethoxy-4-[(E)-[(3R)-3-methyl-2-oxocyclohexylidene]methyl]phenoxy]-N,N-dimethylpropanamide |
| SMILES | CCOc1cc(/C=C2\CCC[C@@H](C)C2=O)ccc1O[C@H](C)C(=O)N(C)C |
| InChI | InChI=1S/C21H29NO4/c1-6-25-19-13-16(12-17-9-7-8-14(2)20(17)23)10-11-18(19)26-15(3)21(24)22(4)5/h10-15H,6-9H2,1-5H3/b17-12+/t14-,15-/m1/s1 |
| InChIKey | IHKNFRJJNMGMBJ-DYNPQAPLSA-N |
| XLogP | 3.71 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|