C19H25N5O3S — CID 9357953
(2R)-2-[4-[(Z)-(3-cyclopropyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)iminomethyl]-2-ethoxyphenoxy]-N,N-dimethylpropanamide (PubChem CID 9357953) has the molecular formula C19H25N5O3S and a molecular weight of 403.51 g/mol. Its IUPAC name is (2R)-2-[4-[(Z)-(3-cyclopropyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)iminomethyl]-2-ethoxyphenoxy]-N,N-dimethylpropanamide.
| Compound Name | (2R)-2-[4-[(Z)-(3-cyclopropyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)iminomethyl]-2-ethoxyphenoxy]-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 9357953 |
| Molecular Formula | C19H25N5O3S |
| Molecular Weight | 403.51 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | (2R)-2-[4-[(Z)-(3-cyclopropyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)iminomethyl]-2-ethoxyphenoxy]-N,N-dimethylpropanamide |
| SMILES | CCOc1cc(/C=N\n2c(C3CC3)n[nH]c2=S)ccc1O[C@H](C)C(=O)N(C)C |
| InChI | InChI=1S/C19H25N5O3S/c1-5-26-16-10-13(6-9-15(16)27-12(2)18(25)23(3)4)11-20-24-17(14-7-8-14)21-22-19(24)28/h6,9-12,14H,5,7-8H2,1-4H3,(H,22,28)/b20-11-/t12-/m1/s1 |
| InChIKey | TUVPWFSXPCYKCK-WXYNYTDUSA-N |
| XLogP | 2.95 |
| TPSA | 84.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.51 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|