C16H12O7 — CID 162854650
7-hydroxy-3-[(2,3,4,5-tetrahydroxyphenyl)methylidene]chromen-4-one (PubChem CID 162854650) has the molecular formula C16H12O7 and a molecular weight of 316.27 g/mol. Its IUPAC name is 7-hydroxy-3-[(2,3,4,5-tetrahydroxyphenyl)methylidene]chromen-4-one.
| Compound Name | 7-hydroxy-3-[(2,3,4,5-tetrahydroxyphenyl)methylidene]chromen-4-one |
|---|---|
| PubChem CID | 162854650 |
| Molecular Formula | C16H12O7 |
| Molecular Weight | 316.27 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | 7-hydroxy-3-[(2,3,4,5-tetrahydroxyphenyl)methylidene]chromen-4-one |
| SMILES | O=C1C(=Cc2cc(O)c(O)c(O)c2O)COc2cc(O)ccc21 |
| InChI | InChI=1S/C16H12O7/c17-9-1-2-10-12(5-9)23-6-8(13(10)19)3-7-4-11(18)15(21)16(22)14(7)20/h1-5,17-18,20-22H,6H2 |
| InChIKey | YMPUCNLVTHKXGE-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 127.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.27 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|