C30H32ClNO5 — CID 118734147
(3E)-3-[[4-(3-morpholin-4-ylpropoxy)phenyl]methylidene]-7-phenylmethoxychromen-4-one;hydrochloride (PubChem CID 118734147) has the molecular formula C30H32ClNO5 and a molecular weight of 522.04 g/mol. Its IUPAC name is (3E)-3-[[4-(3-morpholin-4-ylpropoxy)phenyl]methylidene]-7-phenylmethoxychromen-4-one;hydrochloride.
| Compound Name | (3E)-3-[[4-(3-morpholin-4-ylpropoxy)phenyl]methylidene]-7-phenylmethoxychromen-4-one;hydrochloride |
|---|---|
| PubChem CID | 118734147 |
| Molecular Formula | C30H32ClNO5 |
| Molecular Weight | 522.04 g/mol |
| Exact Mass | 521.20 |
| IUPAC Name | (3E)-3-[[4-(3-morpholin-4-ylpropoxy)phenyl]methylidene]-7-phenylmethoxychromen-4-one;hydrochloride |
| SMILES | Cl.O=C1/C(=C/c2ccc(OCCCN3CCOCC3)cc2)COc2cc(OCc3ccccc3)ccc21 |
| InChI | InChI=1S/C30H31NO5.ClH/c32-30-25(19-23-7-9-26(10-8-23)34-16-4-13-31-14-17-33-18-15-31)22-36-29-20-27(11-12-28(29)30)35-21-24-5-2-1-3-6-24;/h1-3,5-12,19-20H,4,13-18,21-22H2;1H/b25-19+; |
| InChIKey | YFSIIKASDGECFM-LUINMZRLSA-N |
| XLogP | 5.45 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.04 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|