C28H33ClN2O4S2 — CID 69057655
(3Z,5E)-1-[4-[2-(diethylamino)ethoxy]benzoyl]-3,5-bis(thiophen-2-ylmethylidene)piperidin-4-one;hydrate;hydrochloride (PubChem CID 69057655) has the molecular formula C28H33ClN2O4S2 and a molecular weight of 561.17 g/mol. Its IUPAC name is (3Z,5E)-1-[4-[2-(diethylamino)ethoxy]benzoyl]-3,5-bis(thiophen-2-ylmethylidene)piperidin-4-one;hydrate;hydrochloride.
| Compound Name | (3Z,5E)-1-[4-[2-(diethylamino)ethoxy]benzoyl]-3,5-bis(thiophen-2-ylmethylidene)piperidin-4-one;hydrate;hydrochloride |
|---|---|
| PubChem CID | 69057655 |
| Molecular Formula | C28H33ClN2O4S2 |
| Molecular Weight | 561.17 g/mol |
| Exact Mass | 560.16 |
| IUPAC Name | (3Z,5E)-1-[4-[2-(diethylamino)ethoxy]benzoyl]-3,5-bis(thiophen-2-ylmethylidene)piperidin-4-one;hydrate;hydrochloride |
| SMILES | CCN(CC)CCOc1ccc(C(=O)N2C/C(=C/c3cccs3)C(=O)/C(=C/c3cccs3)C2)cc1.Cl.O |
| InChI | InChI=1S/C28H30N2O3S2.ClH.H2O/c1-3-29(4-2)13-14-33-24-11-9-21(10-12-24)28(32)30-19-22(17-25-7-5-15-34-25)27(31)23(20-30)18-26-8-6-16-35-26;;/h5-12,15-18H,3-4,13-14,19-20H2,1-2H3;1H;1H2/b22-17-,23-18+;; |
| InChIKey | GPDCBTBXYISYDY-AVYPFWKQSA-N |
| XLogP | 5.32 |
| TPSA | 81.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.17 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|