C21H22N2O6S — CID 55361990
[2-(2-methyl-3,4-dihydro-2H-1,5-benzothiazepin-5-yl)-2-oxoethyl] 4-ethoxy-3-nitrobenzoate (PubChem CID 55361990) has the molecular formula C21H22N2O6S and a molecular weight of 430.48 g/mol. Its IUPAC name is [2-(2-methyl-3,4-dihydro-2H-1,5-benzothiazepin-5-yl)-2-oxoethyl] 4-ethoxy-3-nitrobenzoate.
| Compound Name | [2-(2-methyl-3,4-dihydro-2H-1,5-benzothiazepin-5-yl)-2-oxoethyl] 4-ethoxy-3-nitrobenzoate |
|---|---|
| PubChem CID | 55361990 |
| Molecular Formula | C21H22N2O6S |
| Molecular Weight | 430.48 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | [2-(2-methyl-3,4-dihydro-2H-1,5-benzothiazepin-5-yl)-2-oxoethyl] 4-ethoxy-3-nitrobenzoate |
| SMILES | CCOc1ccc(C(=O)OCC(=O)N2CCC(C)Sc3ccccc32)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H22N2O6S/c1-3-28-18-9-8-15(12-17(18)23(26)27)21(25)29-13-20(24)22-11-10-14(2)30-19-7-5-4-6-16(19)22/h4-9,12,14H,3,10-11,13H2,1-2H3 |
| InChIKey | SFSRXYJPZCMDCL-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.48 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|