C22H24N2O7S — CID 55404855
[2-(2-methyl-3,4-dihydro-2H-1,5-benzothiazepin-5-yl)-2-oxoethyl] 4-ethoxy-5-methoxy-2-nitrobenzoate (PubChem CID 55404855) has the molecular formula C22H24N2O7S and a molecular weight of 460.51 g/mol. Its IUPAC name is [2-(2-methyl-3,4-dihydro-2H-1,5-benzothiazepin-5-yl)-2-oxoethyl] 4-ethoxy-5-methoxy-2-nitrobenzoate.
| Compound Name | [2-(2-methyl-3,4-dihydro-2H-1,5-benzothiazepin-5-yl)-2-oxoethyl] 4-ethoxy-5-methoxy-2-nitrobenzoate |
|---|---|
| PubChem CID | 55404855 |
| Molecular Formula | C22H24N2O7S |
| Molecular Weight | 460.51 g/mol |
| Exact Mass | 460.13 |
| IUPAC Name | [2-(2-methyl-3,4-dihydro-2H-1,5-benzothiazepin-5-yl)-2-oxoethyl] 4-ethoxy-5-methoxy-2-nitrobenzoate |
| SMILES | CCOc1cc([N+](=O)[O-])c(C(=O)OCC(=O)N2CCC(C)Sc3ccccc32)cc1OC |
| InChI | InChI=1S/C22H24N2O7S/c1-4-30-19-12-17(24(27)28)15(11-18(19)29-3)22(26)31-13-21(25)23-10-9-14(2)32-20-8-6-5-7-16(20)23/h5-8,11-12,14H,4,9-10,13H2,1-3H3 |
| InChIKey | XEJVSLSXWZWKRX-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 108.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.51 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|