C19H26N2O7 — CID 8666246
[2-[(3R,5S)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl] 5-ethoxy-4-methoxy-2-nitrobenzoate (PubChem CID 8666246) has the molecular formula C19H26N2O7 and a molecular weight of 394.42 g/mol. Its IUPAC name is [2-[(3R,5S)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl] 5-ethoxy-4-methoxy-2-nitrobenzoate.
| Compound Name | [2-[(3R,5S)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl] 5-ethoxy-4-methoxy-2-nitrobenzoate |
|---|---|
| PubChem CID | 8666246 |
| Molecular Formula | C19H26N2O7 |
| Molecular Weight | 394.42 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | [2-[(3R,5S)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl] 5-ethoxy-4-methoxy-2-nitrobenzoate |
| SMILES | CCOc1cc(C(=O)OCC(=O)N2C[C@H](C)C[C@H](C)C2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C19H26N2O7/c1-5-27-17-7-14(15(21(24)25)8-16(17)26-4)19(23)28-11-18(22)20-9-12(2)6-13(3)10-20/h7-8,12-13H,5-6,9-11H2,1-4H3/t12-,13+ |
| InChIKey | KWRCHCVSAANUDD-BETUJISGSA-N |
| XLogP | 2.66 |
| TPSA | 108.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.42 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|