C18H24N2O7 — CID 2615360
[2-[(3R,5R)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl] 4,5-dimethoxy-2-nitrobenzoate (PubChem CID 2615360) has the molecular formula C18H24N2O7 and a molecular weight of 380.40 g/mol. Its IUPAC name is [2-[(3R,5R)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl] 4,5-dimethoxy-2-nitrobenzoate.
| Compound Name | [2-[(3R,5R)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl] 4,5-dimethoxy-2-nitrobenzoate |
|---|---|
| PubChem CID | 2615360 |
| Molecular Formula | C18H24N2O7 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | [2-[(3R,5R)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl] 4,5-dimethoxy-2-nitrobenzoate |
| SMILES | COc1cc(C(=O)OCC(=O)N2C[C@H](C)C[C@@H](C)C2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C18H24N2O7/c1-11-5-12(2)9-19(8-11)17(21)10-27-18(22)13-6-15(25-3)16(26-4)7-14(13)20(23)24/h6-7,11-12H,5,8-10H2,1-4H3/t11-,12-/m1/s1 |
| InChIKey | RLXBLEBUIPMYRC-VXGBXAGGSA-N |
| XLogP | 2.27 |
| TPSA | 108.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|