C17H24N2O3S — CID 95303191
[(2S)-2-[(2S)-1-methylpyrrolidin-2-yl]pyrrolidin-1-yl]-(3-methylsulfonylphenyl)methanone (PubChem CID 95303191) has the molecular formula C17H24N2O3S and a molecular weight of 336.46 g/mol. Its IUPAC name is [(2S)-2-[(2S)-1-methylpyrrolidin-2-yl]pyrrolidin-1-yl]-(3-methylsulfonylphenyl)methanone.
| Compound Name | [(2S)-2-[(2S)-1-methylpyrrolidin-2-yl]pyrrolidin-1-yl]-(3-methylsulfonylphenyl)methanone |
|---|---|
| PubChem CID | 95303191 |
| Molecular Formula | C17H24N2O3S |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | [(2S)-2-[(2S)-1-methylpyrrolidin-2-yl]pyrrolidin-1-yl]-(3-methylsulfonylphenyl)methanone |
| SMILES | CN1CCC[C@H]1[C@@H]1CCCN1C(=O)c1cccc(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C17H24N2O3S/c1-18-10-4-8-15(18)16-9-5-11-19(16)17(20)13-6-3-7-14(12-13)23(2,21)22/h3,6-7,12,15-16H,4-5,8-11H2,1-2H3/t15-,16-/m0/s1 |
| InChIKey | SIKNHNQAMAZVNF-HOTGVXAUSA-N |
| XLogP | 1.79 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |