C27H21NO5 — CID 77482241
(4-nitrophenyl) 3-[2-(4-hydroxy-3,5-dimethylphenyl)ethenyl]naphthalene-2-carboxylate (PubChem CID 77482241) has the molecular formula C27H21NO5 and a molecular weight of 439.47 g/mol. Its IUPAC name is (4-nitrophenyl) 3-[2-(4-hydroxy-3,5-dimethylphenyl)ethenyl]naphthalene-2-carboxylate.
| Compound Name | (4-nitrophenyl) 3-[2-(4-hydroxy-3,5-dimethylphenyl)ethenyl]naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 77482241 |
| Molecular Formula | C27H21NO5 |
| Molecular Weight | 439.47 g/mol |
| Exact Mass | 439.14 |
| IUPAC Name | (4-nitrophenyl) 3-[2-(4-hydroxy-3,5-dimethylphenyl)ethenyl]naphthalene-2-carboxylate |
| SMILES | Cc1cc(C=Cc2cc3ccccc3cc2C(=O)Oc2ccc([N+](=O)[O-])cc2)cc(C)c1O |
| InChI | InChI=1S/C27H21NO5/c1-17-13-19(14-18(2)26(17)29)7-8-22-15-20-5-3-4-6-21(20)16-25(22)27(30)33-24-11-9-23(10-12-24)28(31)32/h3-16,29H,1-2H3 |
| InChIKey | YFRPHKDWRPBNOB-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 89.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.47 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|