C17H16N4O6S — CID 142867636
[2-amino-4-(methylamino)quinazolin-6-yl]methyl 2-sulfooxybenzoate (PubChem CID 142867636) has the molecular formula C17H16N4O6S and a molecular weight of 404.40 g/mol. Its IUPAC name is [2-amino-4-(methylamino)quinazolin-6-yl]methyl 2-sulfooxybenzoate.
| Compound Name | [2-amino-4-(methylamino)quinazolin-6-yl]methyl 2-sulfooxybenzoate |
|---|---|
| PubChem CID | 142867636 |
| Molecular Formula | C17H16N4O6S |
| Molecular Weight | 404.40 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | [2-amino-4-(methylamino)quinazolin-6-yl]methyl 2-sulfooxybenzoate |
| SMILES | CNc1nc(N)nc2ccc(COC(=O)c3ccccc3OS(=O)(=O)O)cc12 |
| InChI | InChI=1S/C17H16N4O6S/c1-19-15-12-8-10(6-7-13(12)20-17(18)21-15)9-26-16(22)11-4-2-3-5-14(11)27-28(23,24)25/h2-8H,9H2,1H3,(H,23,24,25)(H3,18,19,20,21) |
| InChIKey | IEDDYRDIHBGFNR-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 153.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.40 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|