C25H22ClN3O8 — CID 17260046
[2-(5-methoxy-2-nitroanilino)-2-oxoethyl] 4-[4-(2-chlorophenoxy)anilino]-4-oxobutanoate (PubChem CID 17260046) has the molecular formula C25H22ClN3O8 and a molecular weight of 527.92 g/mol. Its IUPAC name is [2-(5-methoxy-2-nitroanilino)-2-oxoethyl] 4-[4-(2-chlorophenoxy)anilino]-4-oxobutanoate.
| Compound Name | [2-(5-methoxy-2-nitroanilino)-2-oxoethyl] 4-[4-(2-chlorophenoxy)anilino]-4-oxobutanoate |
|---|---|
| PubChem CID | 17260046 |
| Molecular Formula | C25H22ClN3O8 |
| Molecular Weight | 527.92 g/mol |
| Exact Mass | 527.11 |
| IUPAC Name | [2-(5-methoxy-2-nitroanilino)-2-oxoethyl] 4-[4-(2-chlorophenoxy)anilino]-4-oxobutanoate |
| SMILES | COc1ccc([N+](=O)[O-])c(NC(=O)COC(=O)CCC(=O)Nc2ccc(Oc3ccccc3Cl)cc2)c1 |
| InChI | InChI=1S/C25H22ClN3O8/c1-35-18-10-11-21(29(33)34)20(14-18)28-24(31)15-36-25(32)13-12-23(30)27-16-6-8-17(9-7-16)37-22-5-3-2-4-19(22)26/h2-11,14H,12-13,15H2,1H3,(H,27,30)(H,28,31) |
| InChIKey | IXQDIFZKKVEFGV-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 146.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.92 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|