C26H24Cl2N2O5 — CID 17258649
[2-(3-chloro-4-methylanilino)-2-oxoethyl] 5-[4-(2-chlorophenoxy)anilino]-5-oxopentanoate (PubChem CID 17258649) has the molecular formula C26H24Cl2N2O5 and a molecular weight of 515.39 g/mol. Its IUPAC name is [2-(3-chloro-4-methylanilino)-2-oxoethyl] 5-[4-(2-chlorophenoxy)anilino]-5-oxopentanoate.
| Compound Name | [2-(3-chloro-4-methylanilino)-2-oxoethyl] 5-[4-(2-chlorophenoxy)anilino]-5-oxopentanoate |
|---|---|
| PubChem CID | 17258649 |
| Molecular Formula | C26H24Cl2N2O5 |
| Molecular Weight | 515.39 g/mol |
| Exact Mass | 514.11 |
| IUPAC Name | [2-(3-chloro-4-methylanilino)-2-oxoethyl] 5-[4-(2-chlorophenoxy)anilino]-5-oxopentanoate |
| SMILES | Cc1ccc(NC(=O)COC(=O)CCCC(=O)Nc2ccc(Oc3ccccc3Cl)cc2)cc1Cl |
| InChI | InChI=1S/C26H24Cl2N2O5/c1-17-9-10-19(15-22(17)28)30-25(32)16-34-26(33)8-4-7-24(31)29-18-11-13-20(14-12-18)35-23-6-3-2-5-21(23)27/h2-3,5-6,9-15H,4,7-8,16H2,1H3,(H,29,31)(H,30,32) |
| InChIKey | KGWJPZFKAZELEB-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.39 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |