C29H24Cl2N2O5 — CID 17260199
[2-(3,4-dichloroanilino)-2-oxoethyl] 5-(4-naphthalen-1-yloxyanilino)-5-oxopentanoate (PubChem CID 17260199) has the molecular formula C29H24Cl2N2O5 and a molecular weight of 551.43 g/mol. Its IUPAC name is [2-(3,4-dichloroanilino)-2-oxoethyl] 5-(4-naphthalen-1-yloxyanilino)-5-oxopentanoate.
| Compound Name | [2-(3,4-dichloroanilino)-2-oxoethyl] 5-(4-naphthalen-1-yloxyanilino)-5-oxopentanoate |
|---|---|
| PubChem CID | 17260199 |
| Molecular Formula | C29H24Cl2N2O5 |
| Molecular Weight | 551.43 g/mol |
| Exact Mass | 550.11 |
| IUPAC Name | [2-(3,4-dichloroanilino)-2-oxoethyl] 5-(4-naphthalen-1-yloxyanilino)-5-oxopentanoate |
| SMILES | O=C(CCCC(=O)OCC(=O)Nc1ccc(Cl)c(Cl)c1)Nc1ccc(Oc2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C29H24Cl2N2O5/c30-24-16-13-21(17-25(24)31)33-28(35)18-37-29(36)10-4-9-27(34)32-20-11-14-22(15-12-20)38-26-8-3-6-19-5-1-2-7-23(19)26/h1-3,5-8,11-17H,4,9-10,18H2,(H,32,34)(H,33,35) |
| InChIKey | BZAAELZKXQFYKY-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.43 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_OC_no_alk_B(4)', 'substructure': 'N/A'} |
|---|