C21H19ClN4O8 — CID 124579897
[2-(5-methoxy-2-nitroanilino)-2-oxoethyl] (3S)-1-[(2-chlorobenzoyl)amino]-5-oxopyrrolidine-3-carboxylate (PubChem CID 124579897) has the molecular formula C21H19ClN4O8 and a molecular weight of 490.86 g/mol. Its IUPAC name is [2-(5-methoxy-2-nitroanilino)-2-oxoethyl] (3S)-1-[(2-chlorobenzoyl)amino]-5-oxopyrrolidine-3-carboxylate.
| Compound Name | [2-(5-methoxy-2-nitroanilino)-2-oxoethyl] (3S)-1-[(2-chlorobenzoyl)amino]-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 124579897 |
| Molecular Formula | C21H19ClN4O8 |
| Molecular Weight | 490.86 g/mol |
| Exact Mass | 490.09 |
| IUPAC Name | [2-(5-methoxy-2-nitroanilino)-2-oxoethyl] (3S)-1-[(2-chlorobenzoyl)amino]-5-oxopyrrolidine-3-carboxylate |
| SMILES | COc1ccc([N+](=O)[O-])c(NC(=O)COC(=O)[C@H]2CC(=O)N(NC(=O)c3ccccc3Cl)C2)c1 |
| InChI | InChI=1S/C21H19ClN4O8/c1-33-13-6-7-17(26(31)32)16(9-13)23-18(27)11-34-21(30)12-8-19(28)25(10-12)24-20(29)14-4-2-3-5-15(14)22/h2-7,9,12H,8,10-11H2,1H3,(H,23,27)(H,24,29)/t12-/m0/s1 |
| InChIKey | ZLRNYKTXJUNGFT-LBPRGKRZSA-N |
| XLogP | 1.93 |
| TPSA | 157.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.86 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|