C21H18Cl2N4O8 — CID 124579234
[2-(5-methoxy-2-nitroanilino)-2-oxoethyl] (3R)-1-[(2,4-dichlorobenzoyl)amino]-5-oxopyrrolidine-3-carboxylate (PubChem CID 124579234) has the molecular formula C21H18Cl2N4O8 and a molecular weight of 525.30 g/mol. Its IUPAC name is [2-(5-methoxy-2-nitroanilino)-2-oxoethyl] (3R)-1-[(2,4-dichlorobenzoyl)amino]-5-oxopyrrolidine-3-carboxylate.
| Compound Name | [2-(5-methoxy-2-nitroanilino)-2-oxoethyl] (3R)-1-[(2,4-dichlorobenzoyl)amino]-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 124579234 |
| Molecular Formula | C21H18Cl2N4O8 |
| Molecular Weight | 525.30 g/mol |
| Exact Mass | 524.05 |
| IUPAC Name | [2-(5-methoxy-2-nitroanilino)-2-oxoethyl] (3R)-1-[(2,4-dichlorobenzoyl)amino]-5-oxopyrrolidine-3-carboxylate |
| SMILES | COc1ccc([N+](=O)[O-])c(NC(=O)COC(=O)[C@@H]2CC(=O)N(NC(=O)c3ccc(Cl)cc3Cl)C2)c1 |
| InChI | InChI=1S/C21H18Cl2N4O8/c1-34-13-3-5-17(27(32)33)16(8-13)24-18(28)10-35-21(31)11-6-19(29)26(9-11)25-20(30)14-4-2-12(22)7-15(14)23/h2-5,7-8,11H,6,9-10H2,1H3,(H,24,28)(H,25,30)/t11-/m1/s1 |
| InChIKey | BUHIZNTVOFOUKE-LLVKDONJSA-N |
| XLogP | 2.59 |
| TPSA | 157.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.30 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|