C20H16Cl2N4O7 — CID 124579014
[2-(2,5-dichloroanilino)-2-oxoethyl] (3R)-1-[(2-nitrobenzoyl)amino]-5-oxopyrrolidine-3-carboxylate (PubChem CID 124579014) has the molecular formula C20H16Cl2N4O7 and a molecular weight of 495.28 g/mol. Its IUPAC name is [2-(2,5-dichloroanilino)-2-oxoethyl] (3R)-1-[(2-nitrobenzoyl)amino]-5-oxopyrrolidine-3-carboxylate.
| Compound Name | [2-(2,5-dichloroanilino)-2-oxoethyl] (3R)-1-[(2-nitrobenzoyl)amino]-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 124579014 |
| Molecular Formula | C20H16Cl2N4O7 |
| Molecular Weight | 495.28 g/mol |
| Exact Mass | 494.04 |
| IUPAC Name | [2-(2,5-dichloroanilino)-2-oxoethyl] (3R)-1-[(2-nitrobenzoyl)amino]-5-oxopyrrolidine-3-carboxylate |
| SMILES | O=C(COC(=O)[C@@H]1CC(=O)N(NC(=O)c2ccccc2[N+](=O)[O-])C1)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C20H16Cl2N4O7/c21-12-5-6-14(22)15(8-12)23-17(27)10-33-20(30)11-7-18(28)25(9-11)24-19(29)13-3-1-2-4-16(13)26(31)32/h1-6,8,11H,7,9-10H2,(H,23,27)(H,24,29)/t11-/m1/s1 |
| InChIKey | PIDQKYOEBBCUFV-LLVKDONJSA-N |
| XLogP | 2.58 |
| TPSA | 147.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.28 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|