C20H15Cl2N3O7 — CID 40878032
[2-(4-nitrophenyl)-2-oxoethyl] (3R)-1-[(2,4-dichlorobenzoyl)amino]-5-oxopyrrolidine-3-carboxylate (PubChem CID 40878032) has the molecular formula C20H15Cl2N3O7 and a molecular weight of 480.26 g/mol. Its IUPAC name is [2-(4-nitrophenyl)-2-oxoethyl] (3R)-1-[(2,4-dichlorobenzoyl)amino]-5-oxopyrrolidine-3-carboxylate.
| Compound Name | [2-(4-nitrophenyl)-2-oxoethyl] (3R)-1-[(2,4-dichlorobenzoyl)amino]-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 40878032 |
| Molecular Formula | C20H15Cl2N3O7 |
| Molecular Weight | 480.26 g/mol |
| Exact Mass | 479.03 |
| IUPAC Name | [2-(4-nitrophenyl)-2-oxoethyl] (3R)-1-[(2,4-dichlorobenzoyl)amino]-5-oxopyrrolidine-3-carboxylate |
| SMILES | O=C(COC(=O)[C@@H]1CC(=O)N(NC(=O)c2ccc(Cl)cc2Cl)C1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H15Cl2N3O7/c21-13-3-6-15(16(22)8-13)19(28)23-24-9-12(7-18(24)27)20(29)32-10-17(26)11-1-4-14(5-2-11)25(30)31/h1-6,8,12H,7,9-10H2,(H,23,28)/t12-/m1/s1 |
| InChIKey | GRYAZVXBBVVNAC-GFCCVEGCSA-N |
| XLogP | 2.82 |
| TPSA | 135.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.26 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|