C20H18N2O5 — CID 4272230
phenacyl 1-benzamido-5-oxopyrrolidine-3-carboxylate (PubChem CID 4272230) has the molecular formula C20H18N2O5 and a molecular weight of 366.37 g/mol. Its IUPAC name is phenacyl 1-benzamido-5-oxopyrrolidine-3-carboxylate.
| Compound Name | phenacyl 1-benzamido-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 4272230 |
| Molecular Formula | C20H18N2O5 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | phenacyl 1-benzamido-5-oxopyrrolidine-3-carboxylate |
| SMILES | O=C(COC(=O)C1CC(=O)N(NC(=O)c2ccccc2)C1)c1ccccc1 |
| InChI | InChI=1S/C20H18N2O5/c23-17(14-7-3-1-4-8-14)13-27-20(26)16-11-18(24)22(12-16)21-19(25)15-9-5-2-6-10-15/h1-10,16H,11-13H2,(H,21,25) |
| InChIKey | RLBVWPPIANPUMQ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |