C26H20N4O10 — CID 98106970
[2-[4-(4-nitrophenoxy)phenyl]-2-oxoethyl] (3R)-1-[(4-nitrobenzoyl)amino]-5-oxopyrrolidine-3-carboxylate (PubChem CID 98106970) has the molecular formula C26H20N4O10 and a molecular weight of 548.46 g/mol. Its IUPAC name is [2-[4-(4-nitrophenoxy)phenyl]-2-oxoethyl] (3R)-1-[(4-nitrobenzoyl)amino]-5-oxopyrrolidine-3-carboxylate.
| Compound Name | [2-[4-(4-nitrophenoxy)phenyl]-2-oxoethyl] (3R)-1-[(4-nitrobenzoyl)amino]-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 98106970 |
| Molecular Formula | C26H20N4O10 |
| Molecular Weight | 548.46 g/mol |
| Exact Mass | 548.12 |
| IUPAC Name | [2-[4-(4-nitrophenoxy)phenyl]-2-oxoethyl] (3R)-1-[(4-nitrobenzoyl)amino]-5-oxopyrrolidine-3-carboxylate |
| SMILES | O=C(COC(=O)[C@@H]1CC(=O)N(NC(=O)c2ccc([N+](=O)[O-])cc2)C1)c1ccc(Oc2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C26H20N4O10/c31-23(16-3-9-21(10-4-16)40-22-11-7-20(8-12-22)30(37)38)15-39-26(34)18-13-24(32)28(14-18)27-25(33)17-1-5-19(6-2-17)29(35)36/h1-12,18H,13-15H2,(H,27,33)/t18-/m1/s1 |
| InChIKey | JIUCWZWVBOAKDE-GOSISDBHSA-N |
| XLogP | 3.21 |
| TPSA | 188.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.46 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|