C15H23FN3O2+ — CID 8907288
ethyl-[2-(2-fluoroanilino)-2-oxoethyl]-[2-oxo-2-(propan-2-ylamino)ethyl]azanium (PubChem CID 8907288) has the molecular formula C15H23FN3O2+ and a molecular weight of 296.37 g/mol. Its IUPAC name is ethyl-[2-(2-fluoroanilino)-2-oxoethyl]-[2-oxo-2-(propan-2-ylamino)ethyl]azanium.
| Compound Name | ethyl-[2-(2-fluoroanilino)-2-oxoethyl]-[2-oxo-2-(propan-2-ylamino)ethyl]azanium |
|---|---|
| PubChem CID | 8907288 |
| Molecular Formula | C15H23FN3O2+ |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | ethyl-[2-(2-fluoroanilino)-2-oxoethyl]-[2-oxo-2-(propan-2-ylamino)ethyl]azanium |
| SMILES | CC[NH+](CC(=O)Nc1ccccc1F)CC(=O)NC(C)C |
| InChI | InChI=1S/C15H22FN3O2/c1-4-19(9-14(20)17-11(2)3)10-15(21)18-13-8-6-5-7-12(13)16/h5-8,11H,4,9-10H2,1-3H3,(H,17,20)(H,18,21)/p+1 |
| InChIKey | IHGMVISRBANHJF-UHFFFAOYSA-O |
| XLogP | 0.19 |
| TPSA | 62.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |